3-(Acryloyloxy)propyltrimethoxysilane
- Product Name3-(Acryloyloxy)propyltrimethoxysilane
- CAS4369-14-6
- CBNumberCB5355981
- MFC9H18O5Si
- MW234.32
- EINECS419-560-6
- MDL NumberMFCD00054803
- MOL File4369-14-6.mol
Chemical Properties
| Boiling point: | 68 °C0.4 mm Hg(lit.) |
| Density | 1.055 g/mL at 25 °C(lit.) |
| vapor pressure | 20.5Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Miscible with organic solvents. |
| form | Liquid |
| Specific Gravity | 1.0 |
| color | Clear colorless |
| Water Solubility | 5.8-4300mg/L at 20℃ |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2046320 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChIKey | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
| LogP | 1.6-2.18 at 20-23℃ |
| CAS DataBase Reference | 4369-14-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(trimethoxysilyl)propyl ester (4369-14-6) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H317-H332-H412 | |||||||||
| Precautionary statements | P261-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,C | |||||||||
| Risk Statements | 37/38-41-52/53-43-37-34-20 | |||||||||
| Safety Statements | 26-39-61-45-36/37/39 | |||||||||
| RIDADR | UN1760 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | UD3810000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|