4369-14-6
| Name | 3-(ACRYLOYLOXY)PROPYLTRIMETHOXYSILANE |
| CAS | 4369-14-6 |
| EINECS(EC#) | 419-560-6 |
| Molecular Formula | C9H18O5Si |
| MDL Number | MFCD00054803 |
| Molecular Weight | 234.32 |
| MOL File | 4369-14-6.mol |
Chemical Properties
| Appearance | Colorless transparent liquid |
| Boiling point | 68 °C0.4 mm Hg(lit.) |
| density | 1.055 g/mL at 25 °C(lit.) |
| vapor pressure | 20.5Pa at 25℃ |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | below 5° C |
| solubility | Miscible with organic solvents. |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 1.0 |
| Water Solubility | 5.8-4300mg/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 2046320 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChIKey | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317-H332-H412 |
| Precautionary statements | P261-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1760 |
| WGK Germany | 3 |
| RTECS | UD3810000 |
| F | 10-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |