1,3-Bis(3,3,3-trifluoropropyl)tetramethyldisilazane
- Product Name1,3-Bis(3,3,3-trifluoropropyl)tetramethyldisilazane
- CAS39482-87-6
- CBNumberCB5274880
- MFC10H21F6NSi2
- MW325.44
- EINECS254-470-9
- MDL NumberMFCD00153070
- MOL File39482-87-6.mol
Chemical Properties
| Boiling point: | 76-79 °C(Press: 10 Torr) |
| Density | 1,11 g/cm3 |
| refractive index | 1.3840-1.3880 |
| Flash point: | 78°C |
| Water Solubility | Decomposes in contact with water,Insoluble in water |
| form | clear liquid |
| pka | 11.56±0.70(Predicted) |
| color | Colorless to Light yellow |
| Specific Gravity | 1.11 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChIKey | ITRFWRDOAWGZFV-UHFFFAOYSA-N |
| SMILES | [Si](N[Si](CCC(F)(F)F)(C)C)(CCC(F)(F)F)(C)C |
| EPA Substance Registry System | Silanamine, N-[dimethyl(3,3,3-trifluoropropyl)silyl]-1,1-dimethyl-1-(3,3,3-trifluoropropyl)- (39482-87-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H227-H315-H319 | |||||||||
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | 1760 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|