1,2-Dianilinoethane
- Product Name1,2-Dianilinoethane
- CAS150-61-8
- CBNumberCB5230224
- MFC14H16N2
- MW212.29
- EINECS205-765-6
- MDL NumberMFCD00003019
- MOL File150-61-8.mol
Chemical Properties
| Melting point: | 65-67 °C(lit.) |
| Boiling point: | 228°C 12mm |
| Density | 1.0799 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 228°C/12mm |
| storage temp. | 2-8°C, protect from light |
| pka | 4.67±0.50(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| Water Solubility | Sparingly soluble in water 0.072 g/L @ 25°C. |
| Merck | 14,2990 |
| BRN | 646740 |
| InChI | InChI=1S/C14H16N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | NOUUUQMKVOUUNR-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC=C1)CNC1=CC=CC=C1 |
| CAS DataBase Reference | 150-61-8(CAS DataBase Reference) |
| EPA Substance Registry System | N,N'-Diphenylethylenediamine (150-61-8) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | KV4800000 | |||||||||
| F | 34 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29214200 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|