5,5'-Dimethyl-2,2'-dipyridyl
- Product Name5,5'-Dimethyl-2,2'-dipyridyl
- CAS1762-34-1
- CBNumberCB4764522
- MFC12H12N2
- MW184.24
- MDL NumberMFCD01740554
- MOL File1762-34-1.mol
Chemical Properties
| Melting point: | 114-117 °C(lit.) |
| Boiling point: | 140℃/3mm |
| Density | 1.060±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 15mg/mL,DMSO: 10mg/mL,Ethanol: 15mg/mL,Ethanol:PBS (pH 7.2) (1:4): 0.2mg/mL |
| form | powder to crystal |
| pka | 4.78±0.32(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C12H12N2/c1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12/h3-8H,1-2H3 |
| InChIKey | PTRATZCAGVBFIQ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=C(C)C=C2)=NC=C(C)C=C1 |
| CAS DataBase Reference | 1762-34-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DW1766000 | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Toxicity | mouse,LD50,intraperitoneal,225mg/kg (225mg/kg),Toxicon. Vol. 23, Pg. 815, 1985. | |||||||||
| NFPA 704: |
|
