Clozapine N-oxide
- Product NameClozapine N-oxide
- CAS34233-69-7
- CBNumberCB4759216
- MFC18H19ClN4O
- MW342.82
- MDL NumberMFCD00210190
- MOL File34233-69-7.mol
Chemical Properties
| Melting point: | 190-248°C |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Soluble in DMSO. |
| form | powder |
| pka | 6.86±0.20(Predicted) |
| color | Yellow |
| biological source | synthetic |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 3 months. |
| InChI | InChI=1S/C18H19ClN4O/c1-23(24)10-8-22(9-11-23)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18/h2-7,12,20H,8-11H2,1H3 |
| InChIKey | OGUCZBIQSYYWEF-UHFFFAOYSA-N |
| SMILES | N1=C(N2CC[N+]([O-])(C)CC2)C2=CC=CC=C2NC2=CC=C(Cl)C=C12 |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H336 | |||||||||
| Precautionary statements | P301+P310+P330 | |||||||||
| target organs | Central nervous system | |||||||||
| Hazard Codes | Xn,T,F | |||||||||
| Risk Statements | 22-36/37/38-39/23/24/25-23/24/25-11 | |||||||||
| Safety Statements | 26-36-45-36/37-16-7 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | HP1760000 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2933599090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral STOT SE 3 |
|||||||||
| NFPA 704: |
|