3-(3,4-Dichlorophenoxy)benzaldehyde
- Product Name3-(3,4-Dichlorophenoxy)benzaldehyde
- CAS79124-76-8
- CBNumberCB4469863
- MFC13H8Cl2O2
- MW267.11
- EINECS279-069-6
- MDL NumberMFCD00003354
- MOL File79124-76-8.mol
Chemical Properties
| Melting point: | 103 °C |
| Boiling point: | 153 °C/0.2 mmHg (lit.) |
| Density | 1.348 g/mL at 25 °C (lit.) |
| refractive index | n 20/D 1.619 (lit.) |
| Flash point: | Not applicable |
| form | solid |
| color | Colorless to yellow |
| InChI | 1S/C13H8Cl2O2/c14-12-5-4-11(7-13(12)15)17-10-3-1-2-9(6-10)8-16/h1-8H |
| InChIKey | ABQHJSHFFLAGHF-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Oc2cccc(C=O)c2)cc1Cl |
Safety
| Symbol(GHS) |
   GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-43-50/53 |
| Safety Statements | 26-36/37/39-60-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 2913000090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications |
Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1 |
| Limited Quantities | 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |