p-Naphtholbenzein
- Product Namep-Naphtholbenzein
- CAS145-50-6
- CBNumberCB4450645
- MFC27H18O2
- MW374.43
- EINECS205-656-3
- MDL NumberMFCD00078492
- MOL File145-50-6.mol
Chemical Properties
| Melting point: | 230-235 °C(lit.) |
| Boiling point: | 463.44°C (rough estimate) |
| Density | 1.0946 (rough estimate) |
| bulk density | 120-300kg/m3 |
| vapor density | 12.9 (vs air) |
| refractive index | 1.4875 (estimate) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | Solubility Insoluble in water; soluble in ethanol, methanol |
| form | Liquid |
| pka | 8.95(at 25℃) |
| color | Pale Red-Brown |
| PH Range | Green (0.0) to yellow (0.8);Yellow (8.2) to green-blue (11.0) |
| Odor | Odorless |
| PH | 0.0, green 0.8, yellow 10.0, blue-green 8.2, yellow |
| Water Solubility | insoluble |
| λmax | 210nm |
| ε(extinction coefficient) | ≥50000 at 207-213nm in methanol at 0.01g/L |
| BRN | 3471575 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C27H18O2/c28-25-16-14-23(19-10-4-6-12-21(19)25)27(18-8-2-1-3-9-18)24-15-17-26(29)22-13-7-5-11-20(22)24/h1-17,28H/b27-24- |
| InChIKey | VDDWRTZCUJCDJM-SOYKGTTHSA-N |
| SMILES | Oc1ccc(\C(c2ccccc2)=C3\C=CC(=O)c4ccccc34)c5ccccc15 |
| CAS DataBase Reference | 145-50-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1(4H)-Naphthalenone, 4-[(4-hydroxy-1-naphthalenyl)phenylmethylene]- (145-50-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29145000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Aquatic Chronic 4 | |||||||||
| NFPA 704: |
|