2-Chloro-4-fluorobenzylamine
- Product Name2-Chloro-4-fluorobenzylamine
- CAS15205-11-5
- CBNumberCB4427872
- MFC7H7ClFN
- MW159.59
- EINECS670-919-5
- MDL NumberMFCD00042532
- MOL File15205-11-5.mol
Chemical Properties
| Melting point: | 172-173 °C(Solv: N,N-dimethylformamide (68-12-2)) |
| Boiling point: | 95 °C |
| Density | 1.28 |
| refractive index | 1.535 |
| Flash point: | >110°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 8.46±0.10(Predicted) |
| color | Colorless to Light yellow |
| Sensitive | Air Sensitive |
| BRN | 2936421 |
| InChI | InChI=1S/C7H7ClFN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H,4,10H2 |
| InChIKey | CBKWAXKMZUULLO-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 15205-11-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | 2735 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2921499090 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|