2-Chloro-6-fluorobenzylamine
- Product Name2-Chloro-6-fluorobenzylamine
- CAS15205-15-9
- CBNumberCB0766856
- MFC7H7ClFN
- MW159.59
- EINECS239-259-1
- MDL NumberMFCD00042458
- MOL File15205-15-9.mol
Chemical Properties
| Boiling point: | 91-93 °C/20 mmHg (lit.) |
| Density | 1.24 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 82 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 8.09±0.10(Predicted) |
| color | Clear colorless to light yellow |
| Sensitive | Air Sensitive |
| BRN | 2357724 |
| InChI | InChI=1S/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2 |
| InChIKey | GVULSXIBCHPJEH-UHFFFAOYSA-N |
| SMILES | C1(CN)=C(F)C=CC=C1Cl |
| CAS DataBase Reference | 15205-15-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H318-H314 | |||||||||
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P405-P501a | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2735 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2921499090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|