Benzyltrimethylsilane
- Product NameBenzyltrimethylsilane
- CAS770-09-2
- CBNumberCB4421380
- MFC10H16Si
- MW164.32
- EINECS212-218-5
- MDL NumberMFCD00039796
- MOL File770-09-2.mol
Chemical Properties
| Boiling point: | 187-190 °C(lit.) |
| Density | 0.863 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 138 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.863 |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1928113 |
| InChI | InChI=1S/C10H16Si/c1-11(2,3)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | MRIWRLGWLMRJIW-UHFFFAOYSA-N |
| SMILES | C1(C[Si](C)(C)C)=CC=CC=C1 |
| CAS DataBase Reference | 770-09-2(CAS DataBase Reference) |
| EPA Substance Registry System | Trimethylbenzylsilane (770-09-2) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H302+H312+H332 | |||||||||
| Precautionary statements | P241-P280a-P303+P361+P353-P501a-P210-P233-P240-P241+P242+P243-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P370+P378-P403+P235-P501 | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 23-24/25 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2931900090 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|