Dimethylphosphoramidous dichloride
- Product NameDimethylphosphoramidous dichloride
- CAS683-85-2
- CBNumberCB4389451
- MFC2H6Cl2NP
- MW145.96
- MDL NumberMFCD00013613
- MOL File683-85-2.mol
Chemical Properties
| Boiling point: | 150 °C (lit.) |
| Density | 1.271 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | −10 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | -1.98±0.70(Predicted) |
| color | Colorless to light yellow |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C2H6Cl2NP/c1-5(2)6(3)4/h1-2H3 |
| InChIKey | XPWWDZRSNFSLRQ-UHFFFAOYSA-N |
| SMILES | P(N(C)C)(Cl)Cl |
| CAS DataBase Reference | 683-85-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H314 | |||||||||
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | F,C | |||||||||
| Risk Statements | 11-14-34 | |||||||||
| Safety Statements | 16-23-26-27-36/37/39-45 | |||||||||
| RIDADR | UN 2924 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2942000000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |
|||||||||
| NFPA 704: |
|