2,4-Dichloro-5-trifluoromethylpyrimidine
- Product Name2,4-Dichloro-5-trifluoromethylpyrimidine
- CAS3932-97-6
- CBNumberCB4237271
- MFC5HCl2F3N2
- MW216.98
- EINECS609-648-4
- MDL NumberMFCD03426408
- MOL File3932-97-6.mol
Chemical Properties
| Boiling point: | 49℃/32mm |
| Density | 1.609 g/mL at 25 °C |
| refractive index | 1.4749 |
| Flash point: | 200 ºF |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Clear Colorless to Pale Yellow Liquid |
| pka | -4.89±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5HCl2F3N2/c6-3-2(5(8,9)10)1-11-4(7)12-3/h1H |
| InChIKey | VABVSVZAESMOCH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(F)(F)F)C(Cl)=N1 |
| CAS DataBase Reference | 3932-97-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,C,T | |||||||||
| Risk Statements | 36/37/38-36-25 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2810 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 8 | |||||||||
| HazardClass | CORROSIVE | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2933599090 | |||||||||
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
|||||||||
| Hazard Classifications |
Acute Tox. 2 Oral Eye Irrit. 2 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
