
3932-97-6
| Name | 2,4-Dichloro-5-trifluoromethylpyrimidine |
| CAS | 3932-97-6 |
| EINECS(EC#) | 609-648-4 |
| Molecular Formula | C5HCl2F3N2 |
| MDL Number | MFCD03426408 |
| Molecular Weight | 216.98 |
| MOL File | 3932-97-6.mol |
Chemical Properties
| Boiling point | 49℃/32mm |
| density | 1.6087 |
| refractive index | 1.4749 |
| Fp | 200 ºF |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Clear Colorless to Pale Yellow Liquid |
| pka | -4.89±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5HCl2F3N2/c6-3-2(5(8,9)10)1-11-4(7)12-3/h1H |
| InChIKey | VABVSVZAESMOCH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(F)(F)F)C(Cl)=N1 |
| CAS DataBase Reference | 3932-97-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,C,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | 8 |
| HazardClass | CORROSIVE |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |
