Norepinephrine tartrate
- Product NameNorepinephrine tartrate
- CAS3414-63-9
- CBNumberCB4135894
- MFC8H11NO3.C4H6O6
- MW319.27
- EINECS222-307-0
- MDL NumberMFCD00132876
- MOL File3414-63-9.mol
Chemical Properties
| Melting point: | 163-165 °C(Solv: methanol, 95% (67-56-1)) |
| form | powder |
| color | White to off-white |
| InChI | InChI=1/C8H11NO3.C4H6O6/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/s3 |
| InChIKey | WNPNNLQNNJQYFA-MVELKYERNA-N |
| SMILES | C1(C(O)CN)=CC=C(O)C(O)=C1.[C@H](O)(C(=O)O)[C@@H](O)C(=O)O |&1:12,17,r| |
| CAS DataBase Reference | 3414-63-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 28-36/37-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | CZ8462500 |
| Storage Class |
6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications |
Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |
| Toxicity | LD50 ipr-mus: 31 mg/kg VHTODE 39,214,1997 |
| REACH Registrations | Active |