Epinephrine bitartrate
- Product NameEpinephrine bitartrate
- CAS51-42-3
- CBNumberCB3108435
- MFC13H19NO9
- MW333.29
- EINECS200-097-1
- MDL NumberMFCD00035077
- MOL File51-42-3.mol
Chemical Properties
| Melting point: | ~155 °C (dec.) |
| refractive index | -16.5 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: soluble |
| form | solid |
| color | white |
| Merck | 13,3650 |
| Stability: | Stable. Incompatible with bases, oxidizing agents, iron, iron salts, copper, copper alloys. |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C9H13NO3.C4H6O6/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;5-1(3(7)8)2(6)4(9)10/h2-4,9-13H,5H2,1H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | YLXIPWWIOISBDD-NDAAPVSOSA-N |
| SMILES | OC1=C(O)C=CC(C(CNC)O)=C1.OC(C(C(C(O)=O)O)O)=O |
| CAS DataBase Reference | 51-42-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T+ |
| Risk Statements | 28-36/37/38 |
| Safety Statements | 26-28-36/37-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | DO3500000 |
| F | 8-10-23 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2937900090 |
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Oral |