Trihexylsilane
- Product NameTrihexylsilane
- CAS2929-52-4
- CBNumberCB3755448
- MFC18H40Si
- MW284.6
- EINECS220-893-2
- MDL NumberMFCD00009519
- MOL File2929-52-4.mol
Chemical Properties
| Boiling point: | 160.5-161 °C (lit.) |
| Density | 0.799 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.799 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | 1S/C18H40Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h19H,4-18H2,1-3H3 |
| InChIKey | IBNSYFQZHBBNLR-UHFFFAOYSA-N |
| SMILES | CCCCCC[SiH](CCCCCC)CCCCCC |
| EPA Substance Registry System | Silane, trihexyl- (2929-52-4) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-37/39-38-51-36/37 | |||||||||
| WGK Germany | 1 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|