2-(p-Amylcinnamoyl)amino-4-chlorobenzoic acid
- Product Name2-(p-Amylcinnamoyl)amino-4-chlorobenzoic acid
- CAS99754-06-0
- CBNumberCB3723445
- MFC21H22ClNO3
- MW371.86
- MDL NumberMFCD00210755
- MOL File99754-06-0.mol
Chemical Properties
| Melting point: | 175-177℃ |
| Boiling point: | 580.493±50.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.247±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | room temp |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| pka | 3.270±0.36(predicted) |
| color | white |
| Sensitive | Light Sensitive |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 3 months. |
| InChI | 1S/C21H22ClNO3/c1-2-3-4-5-15-6-8-16(9-7-15)10-13-20(24)23-19-14-17(22)11-12-18(19)21(25)26/h6-14H,2-5H2,1H3,(H,23,24)(H,25,26)/b13-10+ |
| InChIKey | MDVFITMPFHDRBZ-JLHYYAGUSA-N |
| SMILES | Clc1cc(c(cc1)C(=O)O)NC(=O)\C=C\c2ccc(cc2)CCCCC |
Safety
| Symbol(GHS) |
 GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| HazardClass | 9 |
| HS Code | 2924299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 1 |