1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane
- Product Name1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane
- CAS7453-26-1
- CBNumberCB3306590
- MFC26H27NSi2
- MW409.67
- EINECS231-227-5
- MDL NumberMFCD00042831
- MOL File7453-26-1.mol
Chemical Properties
| Melting point: | 87-89 °C (lit.) 87-89 °C |
| Boiling point: | 210-220 °C (0.5 mmHg) |
| Density | 1.07±0.1 g/cm3(Predicted) |
| Flash point: | >110°C |
| storage temp. | 2-8°C, protect from light |
| pka | 5.56±0.70(Predicted) |
| form | solid |
| color | White |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2952534 |
| InChI | 1S/C26H27NSi2/c1-28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)27-29(2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27H,1-2H3 |
| InChIKey | YFONAHAKNVIHPT-UHFFFAOYSA-N |
| SMILES | C[Si](N[Si](C)(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | Yes |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |