4,4'-Dipyridyl disulfide
- Product Name4,4'-Dipyridyl disulfide
- CAS2645-22-9
- CBNumberCB3285109
- MFC10H8N2S2
- MW220.31
- EINECS220-158-6
- MDL NumberMFCD00006423
- MOL File2645-22-9.mol
Chemical Properties
| Melting point: | 76-78 °C(lit.) |
| Boiling point: | 356.1±17.0 °C(Predicted) |
| Density | 1.3078 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | 95% ethanol: soluble5%, clear, colorless to light yellow |
| form | Crystalline Powder |
| pka | 3.60±0.26(Predicted) |
| color | White to orange |
| BRN | 154742 |
| InChI | InChI=1S/C10H8N2S2/c1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10/h1-8H |
| InChIKey | UHBAPGWWRFVTFS-UHFFFAOYSA-N |
| SMILES | S(C1C=CN=CC=1)SC1C=CN=CC=1 |
| CAS DataBase Reference | 2645-22-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 4,4'-dithiobis-(2645-22-9) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H335-H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|