Aleuritic acid
- Product NameAleuritic acid
- CAS533-87-9
- CBNumberCB3240263
- MFC16H32O5
- MW304.42
- EINECS208-578-8
- MDL NumberMFCD00135596
- MOL File533-87-9.mol
Chemical Properties
| Melting point: | 100-101 °C(lit.) |
| Boiling point: | 365.24°C (rough estimate) |
| Density | 1.085 |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Ethyl Acetate (Slightly, Heated） |
| pka | 4.78±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | Soluble in water, alcohol, acetic acid and acetone. |
| Merck | 14,231 |
| BRN | 1727724 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | MEHUJCGAYMDLEL-CABCVRRESA-N |
| SMILES | OCCCCCC[C@H](O)[C@H](O)CCCCCCCC(O)=O |
| LogP | 2.830 |
| CAS DataBase Reference | 533-87-9(CAS DataBase Reference) |
| EPA Substance Registry System | .alpha.-Aleuritic acid (533-87-9) |
Safety
| Symbol(GHS) |
 GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | ML9850000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2918190090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|