3-Cyanopropyltriethoxysilane
- Product Name3-Cyanopropyltriethoxysilane
- CAS1067-47-6
- CBNumberCB3199338
- MFC10H21NO3Si
- MW231.36
- EINECS213-931-4
- MDL NumberMFCD00042636
- MOL File1067-47-6.mol
Chemical Properties
| Boiling point: | 100-101 °C6 mm Hg(lit.) |
| Density | 0.966 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| Specific Gravity | 0.961 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible in water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1942237 |
| InChI | InChI=1S/C10H21NO3Si/c1-4-12-15(13-5-2,14-6-3)10-8-7-9-11/h4-8,10H2,1-3H3 |
| InChIKey | VGIURMCNTDVGJM-UHFFFAOYSA-N |
| SMILES | C(#N)CCC[Si](OCC)(OCC)OCC |
| CAS DataBase Reference | 1067-47-6(CAS DataBase Reference) |
| EPA Substance Registry System | Butanenitrile, 4-(triethoxysilyl)- (1067-47-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H227-H315-H319 | |||||||||
| Precautionary statements | P210e-P280a-P305+P351+P338-P403+P235-P501a | |||||||||
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) | |||||||||
| Risk Statements | 36/38 | |||||||||
| Safety Statements | 23-24/25 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | VV2785000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|