trans-2-Hexenyl acetate
- Product Nametrans-2-Hexenyl acetate
- CAS2497-18-9
- CBNumberCB2482008
- MFC8H14O2
- MW142.2
- EINECS219-680-7
- MDL NumberMFCD00009474
- MOL File2497-18-9.mol
Chemical Properties
| Melting point: | -65.52°C (estimate) |
| Boiling point: | 165 °C |
| Density | 0.90 |
| refractive index | 1.43 |
| FEMA | 2564 | 2-HEXEN-1-YL ACETATE (E) |
| Flash point: | 64 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Almost insoluble in water, soluble in alcohol and oils. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.90 |
| Odor | Powerful and fresh-green, sweet and fruity, very “natural” odor |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 1355 |
| BRN | 1721851 |
| Stability: | Stable. Combustible. Incompatible with strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions | FLAVOURING PERFUMING FRAGRANCE |
| InChI | 1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | HRHOWZHRCRZVCU-AATRIKPKSA-N |
| SMILES | [H]\C(CCC)=C(\[H])COC(C)=O |
| LogP | 2.58 |
| CAS DataBase Reference | 2497-18-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hexen-1-ol, acetate, (E)-(2497-18-9) |
| EPA Substance Registry System | 2-Hexen-1-ol, acetate, (2E)- (2497-18-9) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| RIDADR | UN 3272 3/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | MP8425000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2915390090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|