6-Nitroquinoxaline-2,3-dione
- Product Name6-Nitroquinoxaline-2,3-dione
- CAS2379-56-8
- CBNumberCB2298126
- MFC8H5N3O4
- MW207.14
- MDL NumberMFCD00517012
- MOL File2379-56-8.mol
Chemical Properties
| Melting point: | 345-347 °C (lit.) |
| Density | 1.555±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 9.14±0.20(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C8H5N3O4/c12-7-8(13)10-6-3-4(11(14)15)1-2-5(6)9-7/h1-3H,(H,9,12)(H,10,13) |
| InChIKey | RYMLSFWVYNAKAR-UHFFFAOYSA-N |
| SMILES | Oc1nc2ccc(cc2nc1O)[N+]([O-])=O |
| CAS DataBase Reference | 2379-56-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H319 | |||||||||
| Precautionary statements | P305+P351+P338 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36 | |||||||||
| Safety Statements | 26-36/37 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933990099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 | |||||||||
| NFPA 704: |
|