4,4,4-Trifluoro-1-(2-naphthyl)-1,3-butanedione
- Product Name4,4,4-Trifluoro-1-(2-naphthyl)-1,3-butanedione
- CAS893-33-4
- CBNumberCB2269083
- MFC14H9F3O2
- MW266.22
- MDL NumberMFCD00054501
- MOL File893-33-4.mol
Chemical Properties
| Melting point: | 70-72 °C(lit.) |
| Boiling point: | 350.7±37.0 °C(Predicted) |
| Density | 1.3216 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| pka | 7.70±0.50(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 1981085 |
| InChI | InChI=1S/C14H9F3O2/c15-14(16,17)13(19)8-12(18)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| InChIKey | WVVLURYIQCXPIV-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C2C(=C1)C=CC=C2)(=O)CC(=O)C(F)(F)F |
| CAS DataBase Reference | 893-33-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Butanedione, 4,4,4-trifluoro-1-(2-naphthalenyl)- (893-33-4) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-10-23 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|