2-Bromoethanol-1,1,2,2-d4
- Product Name2-Bromoethanol-1,1,2,2-d4
- CAS81764-55-8
- CBNumberCB1675375
- MFC2HBrD4O
- MW128.99
- MDL NumberMFCD00142881
- MOL File81764-55-8.mol
Chemical Properties
| Boiling point: | 56-57 °C20 mm Hg(lit.) |
| Density | 1.819 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | Liquid |
| color | Colourless to Pale Yellow |
| InChI | 1S/C2H5BrO/c3-1-2-4/h4H,1-2H2/i1D2,2D2 |
| InChIKey | LDLCZOVUSADOIV-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(O)C([2H])([2H])Br |
| CAS Number Unlabeled | 540-51-2 |
Safety
| Symbol(GHS) |
  GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314 |
| Precautionary statements | P261-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28-34-40 |
| Safety Statements | 23-36/37/39-45 |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 3 |
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |