2,4-Difluorobenzylamine
- Product Name2,4-Difluorobenzylamine
- CAS72235-52-0
- CBNumberCB1361665
- MFC7H7F2N
- MW143.13
- EINECS276-502-0
- MDL NumberMFCD00010142
- MOL File72235-52-0.mol
Chemical Properties
| Melting point: | 255-256 °C(Solv: N,N-dimethylformamide (68-12-2)) |
| Boiling point: | 57 °C/8 mmHg |
| Density | 1.22 |
| refractive index | 1.49 |
| Flash point: | 68 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 8.58±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.204 |
| Sensitive | Air Sensitive |
| BRN | 3539259 |
| InChI | InChI=1S/C7H7F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 |
| InChIKey | QDZZDVQGBKTLHV-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(F)C=C1F |
| CAS DataBase Reference | 72235-52-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-27-36/37/39-45-25 | |||||||||
| RIDADR | UN 2735 8/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2921499090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|