Phenylisoquinoline
- Product NamePhenylisoquinoline
- CAS3297-72-1
- CBNumberCB11075341
- MFC15H11N
- MW205.25
- MDL NumberMFCD00093934
- MOL File3297-72-1.mol
Chemical Properties
| Melting point: | 96 °C |
| Boiling point: | 130 °C / 10mmHg |
| Density | 1.1155 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Acetone |
| form | powder |
| pka | 4.71±0.30(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C15H11N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-11H |
| InChIKey | LPCWDYWZIWDTCV-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)C2=C(C=CC=C2)C=CN=1 |
| CAS DataBase Reference | 3297-72-1 |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-37/38-41 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933490090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|