1-(2-Hydroxyethyl)-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
- Product Name1-(2-Hydroxyethyl)-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
- CAS174899-86-6
- CBNumberCB0794422
- MFC6H11N2O.C2F6NO4S2
- MW407.311
- EINECS200-144-5
- MDL NumberMFCD09038874
- MOL File174899-86-6.mol
Chemical Properties
| Density | 1.57 |
| refractive index | 1.43 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H11N2O.C2F6NO4S2/c1-7-2-3-8(6-7)4-5-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-3,6,9H,4-5H2,1H3;/q+1;-1 |
| InChIKey | GIIZYNGNGTZORC-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(C(F)(F)F)=O.[N+]1(C)C=CN(CCO)C=1 |
| CAS DataBase Reference | 174899-86-6 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | |||||||||
| HS Code | 2935.90.9500 | |||||||||
| NFPA 704: |
|