(+)-Diisopinocampheyl chloroborane
- Product Name(+)-Diisopinocampheyl chloroborane
- CAS112246-73-8
- CBNumberCB0413893
- MFC20H34BCl
- MW320.75
- MDL NumberMFCD00074808
- MOL File112246-73-8.mol
Chemical Properties
| Melting point: | 53-55 °C(lit.) |
| Boiling point: | 369.6±25.0 °C(Predicted) |
| Density | 0.88 |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | sol in both polar and nonpolar aprotic solvents like diethyl ether, THF, methylene chloride, pentane, hexane, etc |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C20H34BCl/c1-11-15-7-13(19(15,3)4)9-17(11)21(22)18-10-14-8-16(12(18)2)20(14,5)6/h11-18H,7-10H2,1-6H3/t11-,12-,13+,14+,15-,16-,17-,18-/m0/s1 |
| InChIKey | PSEHHVRCDVOTID-YYNWCRCSSA-N |
| SMILES | B(Cl)([C@H]1C[C@@]2([H])C[C@]([H])(C2(C)C)[C@@H]1C)[C@H]1C[C@@]2([H])C[C@]([H])(C2(C)C)[C@@H]1C |
| CAS DataBase Reference | 112246-73-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|