1-Butyl-2,3-dimethylimidazolium tetrafluoroborate
- Product Name1-Butyl-2,3-dimethylimidazolium tetrafluoroborate
- CAS402846-78-0
- CBNumberCB0413646
- MFC9H17BF4N2
- MW240.05
- EINECS200-145-6
- MDL NumberMFCD03427618
- MOL File402846-78-0.mol
Chemical Properties
| Melting point: | 34 °C |
| Density | 1.198 g/mL at 20 °C (lit.) |
| Flash point: | Not applicable |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| InChI | 1S/C9H17N2.BF4/c1-4-5-6-11-8-7-10(3)9(11)2;2-1(3,4)5/h7-8H,4-6H2,1-3H3;/q+1;-1 |
| InChIKey | VCAIYEJBOWHUGP-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.CCCCn1cc[n+](C)c1C |
| CAS DataBase Reference | 402846-78-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H314 | |||||||||
| Precautionary statements | P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 | |||||||||
| PPE | Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 37/39-26 | |||||||||
| RIDADR | 1759 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2933290090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|