N,N'-Dimethyl-1,2-ethanediamine
- Product NameN,N'-Dimethyl-1,2-ethanediamine
- CAS110-70-3
- CBNumberCB0353432
- MFC4H12N2
- MW88.15
- EINECS203-793-3
- MDL NumberMFCD00008290
- MOL File110-70-3.mol
Chemical Properties
| Melting point: | 1.63°C (estimate) |
| Boiling point: | 120 °C (248 °F; 393 K) |
| Density | 0.819 g/mL |
| refractive index | 1.43 |
| Flash point: | 26 °C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Miscible with chloroform and dichloromethane. |
| form | liquid |
| pka | 10.54±0.10(Predicted) |
| color | Colorless |
| Specific Gravity | 0.828 |
| Sensitive | Air Sensitive |
| BRN | 878142 |
| InChI | 1S/C4H12N2/c1-5-3-4-6-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| SMILES | CNCCNC |
| LogP | -0.620 |
| CAS DataBase Reference | 110-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | CH3NHCH2CH2NHCH3(110-70-3) |
| EPA Substance Registry System | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H314 | |||||||||
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 10-34-20/21/22 | |||||||||
| Safety Statements | 26-36/37/39-45-16 | |||||||||
| RIDADR | UN 2734 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | KV4250000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2921290090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
|||||||||
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|