Chloro(dodecyl)dimethylsilane
- Product NameChloro(dodecyl)dimethylsilane
- CAS66604-31-7
- CBNumberCB0223489
- MFC14H31ClSi
- MW262.93
- EINECS266-421-9
- MDL NumberMFCD00043326
- MOL File66604-31-7.mol
Chemical Properties
| Boiling point: | 291-293 °C |
| Density | 0.865 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 110°C |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 0.865 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 5240407 |
| InChI | InChI=1S/C14H31ClSi/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15/h16H,3-14H2,1-2H3 |
| InChIKey | WEJOUFHBSYHICH-UHFFFAOYSA-N |
| SMILES | [SiH](CCCCCCCCCCCCCl)(C)C |
| CAS DataBase Reference | 66604-31-7 |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2987 8/PG 2 | |||||||||
| WGK Germany | 1 | |||||||||
| F | 10-21 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|