Ethyl chlorofluoroacetate
- Product NameEthyl chlorofluoroacetate
- CAS401-56-9
- CBNumberCB0133418
- MFC4H6ClFO2
- MW140.54
- EINECS206-930-5
- MDL NumberMFCD00039333
- MOL File401-56-9.mol
Chemical Properties
| Boiling point: | 133 °C (lit.) |
| Density | 1.212 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.225 |
| BRN | 1748679 |
| InChI | InChI=1S/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 |
| InChIKey | WUHVJSONZHSDFC-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)F |
| CAS DataBase Reference | 401-56-9(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, chlorofluoro-, ethyl ester (401-56-9) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H314 | |||||||||
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C,F,Xi | |||||||||
| Risk Statements | 10-34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2920 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Flammable | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29159000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Flam. Liq. 3 Skin Corr. 1B |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|