Neopentyl glycol diacrylate
- Product NameNeopentyl glycol diacrylate
- CAS2223-82-7
- CBNumberCB9706831
- MFC11H16O4
- MW212.24
- EINECS218-741-5
- MDL NumberMFCD00048148
- MOL File2223-82-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 6°C(lit.) |
| Boiling point | 96°C/0.8mmHg(lit.) |
| Density | 1.031 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Store at room temperature |
| Water Solubility | Practically insoluble in water |
| solubility | Soluble in ether, alcohol |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Viscosity | 10 cp (25C) |
| Henry's Law Constant | 2.7×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C11H16O4/c1-5-9(12)14-7-11(3,4)8-15-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | MXFQRSUWYYSPOC-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C=C)C(C)(C)COC(=O)C=C |
| CAS DataBase Reference | 2223-82-7(CAS DataBase Reference) |
| EWG's Food Scores | 3 |
| FDA UNII | 0OHU17DNNU |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H311-H315-H317-H319 | |||||||||
| Precautionary statements | P280-P302+P352+P312-P305+P351+P338 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 24-36/38-43 | |||||||||
| Safety Statements | 28-39-45 | |||||||||
| RIDADR | UN 2810 6.1/PG 2 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | AS8925000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29159000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 | |||||||||
| Hazardous Substances Data | 2223-82-7(Hazardous Substances Data) | |||||||||
| Toxicity | rabbit,LD50,skin,180uL/kg (0.18mL/kg),LUNGS, THORAX, OR RESPIRATION: ACUTE PULMONARY EDEMABLOOD: HEMORRHAGESKIN AND APPENDAGES (SKIN): "DERMATITIS, OTHER: AFTER SYSTEMIC EXPOSURE",National Technical Information Service. Vol. OTS0537547, | |||||||||
| NFPA 704: |
|
