Bis(trimethylsilylmethyl) sulfide
- Product NameBis(trimethylsilylmethyl) sulfide
- CAS4712-51-0
- CBNumberCB9670927
- MFC8H22SSi2
- MW206.5
- MDL NumberMFCD00039797
- MOL File4712-51-0.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 88 °C/21 mmHg (lit.) |
| Density | 0.844 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point | 65-66°C/5mm |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.844 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 1740046 |
| InChI | 1S/C8H22SSi2/c1-10(2,3)7-9-8-11(4,5)6/h7-8H2,1-6H3 |
| InChIKey | GISUCMFTNKRCPF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CSC[Si](C)(C)C |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| F | 10-13 |
| TSCA | No |
| HS Code | 2931.90.9010 |
| Storage Class | 10 - Combustible liquids |
