4,5-Dichloro-2-methylpyridazin-3-one
- Product Name4,5-Dichloro-2-methylpyridazin-3-one
- CAS933-76-6
- CBNumberCB8728203
- MFC5H4Cl2N2O
- MW179
- MDL NumberMFCD00051686
- MOL File933-76-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 87-91 °C(lit.) |
| Boiling point | 197.2±50.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Ethanol |
| form | powder to crystal |
| pka | -3.57±0.20(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C5H4Cl2N2O/c1-9-5(10)4(7)3(6)2-8-9/h2H,1H3 |
| InChIKey | ACKBTCUMGAHRIE-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)N=CC(Cl)=C1Cl |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H317-H319-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38-43 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | UR6188000 | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29339980 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 | |||||||||
| NFPA 704: |
|
