Tetrakis(hydroxymethyl)phosphonium sulfate
- Product NameTetrakis(hydroxymethyl)phosphonium sulfate
- CAS55566-30-8
- CBNumberCB8461663
- MFC8H24O12P2S
- MW406.28
- EINECS259-709-0
- MDL NumberMFCD00054243
- MOL File55566-30-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -35°C |
| Boiling point | 111°C |
| Density | 1.4 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 20℃ |
| Flash point | 96 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| Specific Gravity | 1.42 |
| color | Colorless to Almost colorless |
| Water Solubility | >=10 g/100 mL at 18 ºC |
| BRN | 8521357 |
| Henry's Law Constant | 5.8×1017 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C4H12O4P.H2O4S/c5-1-9(2-6,3-7)4-8;1-5(2,3)4/h5-8H,1-4H2;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | HFDZMBPIARIWLN-UHFFFAOYSA-M |
| SMILES | [P+](CO)(CO)(CO)CO.S([O-])(=O)(=O)O |
| LogP | -9.8 |
| Toxicology and Carcinogenesis | Toxicology and Carcinogenesis Studies of Tetrakis(hydroxymethyl)phosphonium sulfate (THPS) (CASRN 55566-30-8) and Tetrakis(hydroxymethyl)phosphonium chloride (THPC) (CASRN 124-64-1) in F344/N Rats and B6C3F1 Mice (Gavage Studies) |
| FDA 21 CFR | 176.300 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H317-H318-H331-H350-H412 | |||||||||
| Precautionary statements | P273-P280-P301+P312-P304+P340+P311-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | C,N,T | |||||||||
| Risk Statements | 22-34-43-50-41-20/22-45 | |||||||||
| Safety Statements | 26-36/37/39-45-61-53 | |||||||||
| RIDADR | UN 2922 8/PG 3 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | TA2570000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319019 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 1B Eye Dam. 1 Skin Sens. 1 | |||||||||
| Hazardous Substances Data | 55566-30-8(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
