4-Nitrocinnamyl alcohol
- Product Name4-Nitrocinnamyl alcohol
- CAS1504-63-8
- CBNumberCB8443979
- MFC9H9NO3
- MW179.17
- MDL NumberMFCD00017045
- MOL File1504-63-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 127-128 °C(lit.) |
| Boiling point | 311.69°C (rough estimate) |
| Density | 1.2822 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| solubility | Soluble in chloroform, dichloromethane and ethyl Acetate. |
| pka | 14.42±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 1948238 |
| InChI | 1S/C9H9NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-6,11H,7H2/b2-1+ |
| InChIKey | LGXXEDSIJZHDBN-OWOJBTEDSA-N |
| SMILES | OC\C=C\c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 1504-63-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propen-1-ol, 3-(4-nitrophenyl)- (1504-63-8) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29062990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
