Methyl triphenyl phosphonium chloride
- Product NameMethyl triphenyl phosphonium chloride
- CAS1031-15-8
- CBNumberCB8428206
- MFC19H18ClP
- MW312.77
- EINECS418-400-2
- MDL NumberMFCD00797851
- MOL File1031-15-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 221°C (dec.) |
| Boiling point | 332.65℃ at 101.3kPa |
| Density | 1.22 at 23℃ |
| vapor pressure | 0.001Pa at 40℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol. |
| form | Solid:crystalline |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| InChI | 1S/C19H18P.ClH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 |
| InChIKey | QRPRIOOKPZSVFN-UHFFFAOYSA-M |
| SMILES | [Cl-].C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| LogP | -1.73 at 20℃ and pH6.3-6.46 |
| Surface tension | 71.4mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 1031-15-8(CAS DataBase Reference) |
| FDA UNII | 0Z16KIM767 |
| UNSPSC Code | 12352002 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H312-H315-H318-H411 | |||||||||
| Precautionary statements | P264-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn;N,N,Xn | |||||||||
| Risk Statements | 21/22-38-41-51/53 | |||||||||
| Safety Statements | 22-26-36/37/39-61 | |||||||||
| RIDADR | UN 3077 | |||||||||
| WGK Germany | 2 | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 | |||||||||
| NFPA 704: |
|
