1031-15-8
| Name | Methyl triphenyl phosphonium chloride |
| CAS | 1031-15-8 |
| EINECS(EC#) | 418-400-2 |
| Molecular Formula | C19H18ClP |
| MDL Number | MFCD00797851 |
| Molecular Weight | 312.77 |
| MOL File | 1031-15-8.mol |
Chemical Properties
| Melting point | 221°C (dec.) |
| Boiling point | 332.65℃ at 101.3kPa |
| density | 1.22 at 23℃ |
| vapor pressure | 0.001Pa at 40℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol. |
| form | Solid:crystalline |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| InChI | 1S/C19H18P.ClH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 |
| InChIKey | QRPRIOOKPZSVFN-UHFFFAOYSA-M |
| SMILES | [Cl-].C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| LogP | -1.73 at 20℃ and pH6.3-6.46 |
| Surface tension | 71.4mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 1031-15-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 |