1,1-Diphenyl-2-picrylhydrazine
- Product Name1,1-Diphenyl-2-picrylhydrazine
- CAS1707-75-1
- CBNumberCB8368335
- MFC18H13N5O6
- MW395.33
- EINECS216-953-2
- MDL NumberMFCD00007229
- MOL File1707-75-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | ~174 °C (dec.)(lit.) |
| Boiling point | 530.2±60.0 °C(Predicted) |
| Density | 1.539±0.06 g/cm3(Predicted) |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| pka | -0.84±0.50(Predicted) |
| color | Orange to Brown to Dark red |
| BRN | 770319 |
| InChI | InChI=1S/C18H13N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19H |
| InChIKey | WCBPJVKVIMMEQC-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC=C1)(C1=CC=CC=C1)NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 1707-75-1(CAS DataBase Reference) |
| EPA Substance Registry System | Hydrazine, 1,1-diphenyl-2-(2,4,6-trinitrophenyl)- (1707-75-1) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H242-H302+H312+H332-H315-H317-H319-H334 | |||||||||
| Precautionary statements | P210-P235-P280-P304+P340+P312-P370+P378-P403 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22 | |||||||||
| Safety Statements | 36/37 | |||||||||
| RIDADR | 1325 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29280000 | |||||||||
| Storage Class | 4.1A - Other explosive hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Self-react. C Skin Irrit. 2 Skin Sens. 1 | |||||||||
| NFPA 704: |
|

