1707-75-1
| Name | 1,1-DIPHENYL-2-PICRYLHYDRAZINE |
| CAS | 1707-75-1 |
| EINECS(EC#) | 216-953-2 |
| Molecular Formula | C18H13N5O6 |
| MDL Number | MFCD00007229 |
| Molecular Weight | 395.33 |
| MOL File | 1707-75-1.mol |
Chemical Properties
| Melting point | ~174 °C (dec.)(lit.) |
| Boiling point | 530.2±60.0 °C(Predicted) |
| density | 1.539±0.06 g/cm3(Predicted) |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| pka | -0.84±0.50(Predicted) |
| color | Orange to Brown to Dark red |
| BRN | 770319 |
| InChI | InChI=1S/C18H13N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19H |
| InChIKey | WCBPJVKVIMMEQC-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC=C1)(C1=CC=CC=C1)NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 1707-75-1(CAS DataBase Reference) |
| EPA Substance Registry System | Hydrazine, 1,1-diphenyl-2-(2,4,6-trinitrophenyl)- (1707-75-1) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1325 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Self-react. C Skin Irrit. 2 Skin Sens. 1 |