| Melting point |
>250°C |
| Boiling point |
693.9±55.0 °C(Predicted) |
| Density |
1.82±0.1 g/cm3(Predicted) |
| solubility |
Solubility Insoluble in water; soluble in N,N-dimethylformamide |
| form |
Solid |
| pka |
4.7(at 25℃) |
| color |
Orange powder |
| PH Range |
Weak green N uorescence (4.2) to strong green N uorescence (5.7) |
| λmax |
478nm, 492nm |
| ex/em |
λex 498, 332 nm; λem 526 nm |
| Major Application |
Sensors, methods of determining human blood-relationship, method for purifying actin in plant cells, phagosomal pH determination |
| Biological Applications |
Analysizing single cells; detecting intracellular analytes, undetectable analytes; as marker for Arginine8-vasotocin (AVT) targetneurons; measuringphagosomalpH; monitoring melting of duplex DNA; temperature gradient focusing; studying actin dynamics in plant cells |
| InChI |
InChI=1S/C21H10F2O7/c22-13-4-11-17(6-15(13)24)29-18-7-16(25)14(23)5-12(18)21(11)10-2-1-8(19(26)27)3-9(10)20(28)30-21/h1-7,24-25H,(H,26,27) |
| InChIKey |
CQJLDIGZTKKPAJ-UHFFFAOYSA-N |
| SMILES |
C12(C3=C(C=C(O)C(F)=C3)OC3=C1C=C(F)C(O)=C3)C1=C(C=C(C(O)=O)C=C1)C(=O)O2 |
