Platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane
- Product NamePlatinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane
- CAS68478-92-2
- CBNumberCB7448548
- MFC8H18OPtSi2
- MW381.48
- EINECS270-844-4
- MDL NumberMFCD00151662
- MOL File68478-92-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 12-13 °C |
| Boiling point | 138 °C |
| Density | 0.984 g/mL at 25 °C |
| vapor pressure | 7 mm Hg ( 21 °C) |
| refractive index | 1.4954 |
| Flash point | 86 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Light yellow to Yellow to Green |
| Specific Gravity | 0.984 |
| Water Solubility | Miscible with toluene, xylene, isopropyl alcohol, double-vinyl silicone oil and vinyl terminated poly(dimethylsiloxane). Immiscible with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Stability | Flammable. Incompatible with reducing agents, oxidizing agents. Contact with water yields hydrogen gas. |
| InChI | 1S/C8H18OSi2.Pt/c1-7-10(3,4)9-11(5,6)8-2;/h7-8H,1-2H2,3-6H3; |
| InChIKey | RCNRJBWHLARWRP-UHFFFAOYSA-N |
| SMILES | [Pt].C[Si](C)(O[Si](C)(C)C=C)C=C |
| EPA Substance Registry System | Platinum, 1,3-diethenyl-1,1,3,3-tetramethyldisiloxane complexes (68478-92-2) |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H304-H312+H332-H315-H319-H335-H373-H412 | |||||||||
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P331 | |||||||||
| Hazard Codes | T,Xi,Xn | |||||||||
| Risk Statements | 61-10-20/21-37/38-41-62-36/37/38-38 | |||||||||
| Safety Statements | 53-16-26-36/37/39-45-36-36/37 | |||||||||
| RIDADR | UN 1307 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 28439000 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|
