2-Chloro-6-trifluoromethylnicotinic acid
- Product Name2-Chloro-6-trifluoromethylnicotinic acid
- CAS280566-45-2
- CBNumberCB7150225
- MFC7H3ClF3NO2
- MW225.55
- EINECS631-076-9
- MDL NumberMFCD01862658
- MOL File280566-45-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 120 °C |
| Boiling point | 271.3±40.0 °C(Predicted) |
| Density | 1.603±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 1.42±0.28(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H3ClF3NO2/c8-5-3(6(13)14)1-2-4(12-5)7(9,10)11/h1-2H,(H,13,14) |
| InChIKey | DXRBTBMFFGEVCX-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C(F)(F)F)=CC=C1C(O)=O |
| CAS DataBase Reference | 280566-45-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P301+P310-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | UN 2811 6.1 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 2933399990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
