| Melting point |
135 °C |
| Boiling point |
150-151 °C (lit.) |
| Density |
0.928 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.413(lit.) |
| Flash point |
112 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| pka |
7.37±0.28(Predicted) |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| BRN |
1750085 |
| Stability |
Stable. Incompatible with strong oxidizing agents. Flammable. |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C6H13NO2/c1-4-9-6(8)5-7(2)3/h4-5H2,1-3H3 |
| InChIKey |
BGCNBOFPABQGNG-UHFFFAOYSA-N |
| SMILES |
C(OCC)(=O)CN(C)C |
| CAS DataBase Reference |
33229-89-9(CAS DataBase Reference) |
| EWG's Food Scores |
1 |
| EPA Substance Registry System |
Glycine, N,N-dimethyl-, ethyl ester (33229-89-9) |
| UNSPSC Code |
12352209 |
| NACRES |
NA.22 |