Lonidamine
- Product NameLonidamine
- CAS50264-69-2
- CBNumberCB6493965
- MFC15H10Cl2N2O2
- MW321.16
- EINECS256-510-0
- MDL NumberMFCD00866285
- MOL File50264-69-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 207-209°C |
| Boiling point | 537.9±45.0 °C(Predicted) |
| Density | 1.4835 (rough estimate) |
| refractive index | 1.6070 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO (up to 25 mg/ml). |
| form | solid |
| pka | 3.00±0.10(Predicted) |
| color | White |
| Stability | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 1 month. |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21/h1-7H,8H2,(H,20,21) |
| InChIKey | WDRYRZXSPDWGEB-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=C(Cl)C=C2Cl)C2=C(C=CC=C2)C(C(O)=O)=N1 |
| CAS DataBase Reference | 50264-69-2(CAS DataBase Reference) |
| FDA UNII | U78804BIDR |
| ATC code | L01XX07 |
| UNSPSC Code | 12352202 |
| NACRES | NA.77 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H351-H360 | |||||||||
| Precautionary statements | P201-P301+P312+P330-P308+P313 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 60-22-40 | |||||||||
| Safety Statements | 53-22-36/37/39-45 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NK7886000 | |||||||||
| HS Code | 29339900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Repr. 1B | |||||||||
| Toxicity | LD50 in mice, rats (mg/kg): 900, 1700 orally; 435, 525 i.p. (Heywood) | |||||||||
| NFPA 704: |
|
