4,4'-(1-Phenylethylidene) biphenol
- Product Name4,4'-(1-Phenylethylidene) biphenol
- CAS1571-75-1
- CBNumberCB6334248
- MFC20H18O2
- MW290.36
- EINECS433-130-5
- MDL NumberMFCD00134687
- MOL File1571-75-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 188-191 °C (lit.) |
| Boiling point | 473.8±35.0 °C(Predicted) |
| Density | 1.179±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | almost transparency in Methanol |
| pka | 10.22±0.10(Predicted) |
| color | White to Almost white |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C20H18O2/c1-20(15-5-3-2-4-6-15,16-7-11-18(21)12-8-16)17-9-13-19(22)14-10-17/h2-14,21-22H,1H3 |
| InChIKey | VOWWYDCFAISREI-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)(C1=CC=CC=C1)C |
| UNSPSC Code | 85151701 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H319 | |||||||||
| Precautionary statements | P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 29072990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 | |||||||||
| NFPA 704: |
|
