1571-75-1
| Name | 4,4'-(1-Phenylethylidene) biphenol |
| CAS | 1571-75-1 |
| EINECS(EC#) | 433-130-5 |
| Molecular Formula | C20H18O2 |
| MDL Number | MFCD00134687 |
| Molecular Weight | 290.36 |
| MOL File | 1571-75-1.mol |
Chemical Properties
| Melting point | 188-191 °C(lit.) |
| Boiling point | 473.8±35.0 °C(Predicted) |
| density | 1.179±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | almost transparency in Methanol |
| form | neat |
| pka | 10.22±0.10(Predicted) |
| color | White to Almost white |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C20H18O2/c1-20(15-5-3-2-4-6-15,16-7-11-18(21)12-8-16)17-9-13-19(22)14-10-17/h2-14,21-22H,1H3 |
| InChIKey | VOWWYDCFAISREI-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)(C1=CC=CC=C1)C |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Inactive |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |